What is the density of fluorenone?

1.13 g/cm³Fluorenone / Density

What is the density of 9-fluorenone in g ml?

0.9

Synonyms Diphenylene ketone;Fluorene ketone
Density (g/ml) 0.9
Boiling Point (°C) 342
Melting Point (°C) 81-85
Refractive Index –

What is the density of 9 Fluorenol?

Predicted data is generated using the ACD/Labs Percepta Platform – PhysChem Module

Density: 1.3±0.1 g/cm3
Vapour Pressure: 0.0±0.9 mmHg at 25°C
Enthalpy of Vaporization: 64.8±3.0 kJ/mol
Flash Point: 131.3±11.5 °C
Index of Refraction: 1.687

What is the total mass in grams of 9-fluorenone?

Identification of 9-Fluorenone Chemical Compound

Chemical Formula C13H8O
Molecular Weight 180.20202 g/mol
IUPAC Name 9H-fluoren-9-one
SMILES String O=C2c1ccccc1c3ccccc23
InChI InChI=1S/C13H8O/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8H

Is 9-fluorenone more polar than Acetylferrocene?

This makes sense with the results, since Ferrocene is nonpolar, 9fluorenone is slightly polar with its carbonyl group, and acetylferrocene is polar with its acetyl group.

Is Fluorenol more polar than fluorenone?

a) Although fluorenone is more polar than fluorenol, more specific interactions between fluorenol and silica account for its slow migration in thin-layer chromatography.

What atom or species is oxidized in the conversion of 9 Fluorenol to 9-fluorenone?

NaOCl
The 9-fluorenone will be oxidized with NaOCl to form the ketone, 9-fluorenone.

Why is fluorenone more polar than fluorene?

Fluorenone is more polar than fluorene because of its C=O. bond. Fluorenone’s spot will be lower than fluorene because of its “stickness.”

Why fluorene move faster down the column than fluorenone?

Why? Fluorene moves faster because its’ polarity is the same as hexane and also opposite of the alumina gel.

Is acetylferrocene or Diacetylferrocene more polar?

1) Consider the compounds ferrocene, acetylferrocene, and diacetylferrocene. a. Which is the most polar and which is the least polar? Answer: Diacetylferrocene is most polar; ferrocene is least polar.

Is Fluorenone polar or nonpolar?

Overall, fluorenone is a polar compound, mainly due to the presence of the ketone. Since oxygen is more electronegative than carbon, there is an unequal sharing of the electrons in the form of the double bond, making it polar.

How is hydroxyfluorene converted to fluorenone?

Hydroxyfluorene can be converted to fluorenone by oxidation. It is a white-cream colored solid at room temperature. Fluorenol is toxic to aquatic organisms including algae, bacteria, and crustaceans. Fluorenol was patented as an insecticide in 1939, and is an algaecide against the green algae Dunaliella bioculata.

What is the fluorenone concentration in Portland Oregon?

RAINWATER: Fluorenone was measured in rainwater during a series of four rainstorms collected in a semirural area in Portland, OR, March-April 1982, at an average concentration of 15 ng/L (1).

Where is the hydroxy group located in Fluorenol?

Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).?) Fluorenol is an alcohol derivative of fluorene. In the most significant isomer, fluoren-9-ol or 9-hydroxyfluorene, the hydroxy group is located on the bridging carbon between the two benzene rings.

What is the standard state of reaction for Fluorenol?

Fluorenol. Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Fluorenol is an alcohol derivative of fluorene. In the most significant isomer, fluoren-9-ol or 9-hydroxyfluorene, the hydroxy group is located on the bridging carbon between the two benzene rings.