What is the molecular weight of C12 H22 O11?
What is the molecular weight of C12 H22 O11?
342.3 g/molTable sugar / Molar mass
What is the mass of CH4?
16.04 g/molMethane / Molar mass
There is only one carbon atom. Hence the molecular mass of CH4 is 16u, which is 16gm/mol. The molecular mass (m) is the mass of a given molecule: it is measured in daltons (Da or u).
What is the name of CHBr3?
| IUPAC Name | bromoform |
|---|---|
| Alternative Names | Bromoform tribromomethane |
| Molecular Formula | CHBr3 |
| Molar Mass | 252.731 g/mol |
| InChI | InChI=1S/CHBr3/c2-1(3)4/h1H |
What is the molar mass of ch3cl?
50.49 g/molChloromethane / Molar mass
What is the molecular weight of table sugar sucrose C12H22O11 and what is its molar mass in g mol?
342.30 g/mol
Chemical Data of Sucrose
| Chemical Formula of Sucrose | C12H22O11 |
|---|---|
| Molar Mass or Molecular Weight | 342.30 g/mol |
| Density | 1.587 g/cm3 |
| Physical Appearance | White, crystalline solid |
| Melting Point | Decomposes at 459 K |
What is C12H22O11?
Sucrose | C12H22O11 – PubChem.
How do you calculate ch4?
We’ll use methane, CH4, as an example. The formula weight of methane is [12.01 + (4 x 1.008)] = 16.04. In terms of mass, methane is (4.032/16.04) x 100 = 25.13% hydrogen and (12.01/16.04) x 100 = 74.87% carbon.
How many valence electrons does CHBr3 have?
The CHBr3 has a total of 26 valence electrons as a result of the foregoing above said reasoning. With the core central carbon atom, the four terminal with three bromine and one hydrogen atoms forms covalent bonds, leaving the carbon atom with a no lone pair in the middle of tetrahedral geometry.
Is CH3Br organic or inorganic?
methyl bromide, also called bromomethane, a colourless, nonflammable, highly toxic gas (readily liquefied) belonging to the family of organic halogen compounds.
What is CH3Cl2?
Chloromethane;chloride | CH3Cl2- – PubChem.
