What is the empirical formula of lysergic acid?
What is the empirical formula of lysergic acid?
C16H16N2O2Lysergic acid / Formula
How do you synthesis lysergic acid?
Lysergic acid would be derived from 2 via an intramolecular Heck reaction. The tetrahydropyridine ring in 2 could be formed through a ring-closing metathesis of diene 3, (4) which would be prepared by reductive amination of aldehyde 4 with amine 5.
What is lysergic acid in?
Lysergic Acid Diethylamide LSD (acid, big “d,” blotters) is a very potent hallucinogen that is made from lysergic acid found in ergot, a fungus that grows on rye and other grains. Its high potency allows effective doses to be applied to absorbent paper, or it can be taken as a liquid or a tablet.
What is c20h25n30?
Lysergic acid diethylamide (LSD)
What is the structure of lysergic acid?
Who synthesized lysergic acid diethylamide?
chemist Albert Hofmann
Lysergic acid diethylamide (LSD) The hallucinogen was synthesized by the addition of diethylamide to ergotamine by the chemist Albert Hofmann at the Sandoz Laboratory. LSD is believed to be one of the most potent mind-altering compounds discovered to date.
What is the name of h25?
Chemical Component Summary | |
---|---|
Name | 5-Chloro-thiophene-2-carboxylic acid ((3S,4S)-1-{[2-fluoro-4-(2-oxo-2H-pyridin-1-yl)-phenylcarbamoyl]-methyl}-4-hydroxy-pyrrolidin-3-yl)-amide |
Identifiers | 5-chloro-N-[(1S,3S,4S)-1-[2-[[2-fluoro-4-(2-oxopyridin-1-yl)phenyl]amino]-2-oxo-ethyl]-4-hydroxy-pyrrolidin-3-yl]thiophene-2-carboxamide |
What is the empirical formula for C16H16N2O2?
Identification of LYSERGIC ACID Chemical Compound
Chemical Formula | C16H16N2O2 |
---|---|
SMILES String | CN1CC(C=C2C1Cc3c[nH]c4cccc2c34)C(O)=O |
InChI | InChI=1S/C16H16N2O2/c1-18-8-10(16(19)20)5-12-11-3-2-4-13-15(11)9(7-17-13)6-14(12)18/h2-5,7,10,14,17H,6,8H2,1H3,(H,19,20)/t10-,14-/m1/s1 |
InChIKey | ZAGRKAFMISFKIO-QMTHXVAHSA-N |