What is dichloropropane used for?
What is dichloropropane used for?
1,2-Dichloropropane (dichloropropane) is a colorless, flammable solvent that evaporates quickly at room temperature and is used as degreaser and dry cleaning fluid. Previously, it was used as an insecticide, but is currently not found in household products.
How is dichloropropane formed?
Dichloropropane does not occur in the natural form. It is obtained primarily in the process of producing propylene oxide. Propylene dichloride is an excellent solvent and can successfully replace other organic substances, such as acetone, toluene and xylene.
What is the common name of 1/2-dichloropropane?
EPA has provisionally classified propylene dichloride as a Group B2, probable human carcinogen. Please Note: Propylene dichloride is also known as 1,2-dichloropropane.
What is the structural formula of 2 2-dichloropropane?
C3H6Cl22,2-dichloropropane / Formula
What are the four isomers of dichloropropane?
They are 1,1-, 1,2-, 1,3-, and 2,2-dichloropropane.
What is the formula of 1/3 dichloropropane?
C3H6Cl21,3-Dichloropropane / Formula
What is the structural formula for the Iupac name of dichloropropane?
C3H6Cl2
| IUPAC Name | 1,2-dichloropropane |
|---|---|
| Molecular Formula | C3H6Cl2 |
| Molar Mass | 112.981 g/mol |
| InChI | InChI=1S/C3H6Cl2/c1-3(5)2-4/h3H,2H2,1H3 |
| InChI Key | KNKRKFALVUDBJE-UHFFFAOYSA-N |
Is 2 Chloropropane secondary?
Bromine atom is attached to a primary carbon i.e. this carbon is attached to only one carbon atom. Hence it is primary alkyl halide. Bromine atom is attached to a secondary carbon i.e. this carbon is attached to two other carbon atoms. Hence it is secondary alkyl halide.
What is the chemical formula of 1/2-dichloropropane?
C3H6Cl21,2-Dichloropropane / Formula
How many isomers does dichloropropane have?
four isomers
And there you have the four isomers of dichloropropane.
How many structural isomers are possible in dichloropropane?
So, there are four isomers of Dichloropropane.
What is the chemical formula of 1 1-dichloropropane?
C3H6Cl21,1-dichloropropane / Formula