What is the structure of 3 Methyl heptane?
What is the structure of 3 Methyl heptane?
C8H183-Methylheptane / Formula
What is the structure of Propenol?
C₃H₈OPropan-1-ol / Formula
What is the skeletal structure for the organic compound 5 Methylhept 3 YNE?
The 5-methylhept-3-yne molecule contains a total of 21 bond(s) There are 7 non-H bond(s), 1 multiple bond(s), 1 rotatable bond(s) and 1 triple bond(s). The 2D chemical structure image of 5-methylhept-3-yne is also called skeletal formula, which is the standard notation for organic molecules.
What is the skeletal formula for 3 Methylheptane?
3-Methylheptane is a branched alkane isomeric to octane. Its structural formula is CH3CH2CH(CH3)CH2CH2CH2CH3.
What is the structure of 5 Ethyl 3-Methylheptane?
5-Ethyl-3-methylheptane-2,4-diol | C10H22O2 – PubChem.
What is the condensed formula of 3-Methylheptane?
3-Methylheptane
| PubChem CID | 11519 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C8H18 |
| Synonyms | 3-METHYLHEPTANE 589-81-1 Heptane, 3-methyl- 2-Ethylhexane 3-methyl-heptane More… |
What are the structural formulas for the propyl alcohol isomers?
These two molecules are structural isomers….
| 1-propanol | 2-propanol | |
|---|---|---|
| condensed structural formula | CH3CH2CH2OH | CH3CHOHCH3 |
| “stick figure” |
What is the structure of 5 Methyl 3 Heptyne?
5-Methyl-3-heptyne | C8H14 – PubChem.
What is the structural formula of 4 methyl 2 Pentyne?
4-Methyl-2-pentyne
| Product Number | M0270 |
|---|---|
| Molecular Formula / Molecular Weight | C6H10 = 82.15 |
| Physical State (20 deg.C) | Liquid |
| CAS RN | 21020-27-9 |
| Reaxys Registry Number | 1731860 |
What is the structure of 5 Ethyl 3 Methylheptane?
