What is the chemical formula of carboxymethyl cellulose?
What is the chemical formula of carboxymethyl cellulose?
| IUPAC Name | acetic acid;2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| Molecular Formula | C8H16O8 |
| Molar Mass | 240.208 g/mol |
| InChI | InChI=1S/C6H12O6.C2H4O2/c7-1-3(9)5(11)6(12)4(10)2-8;1-2(3)4/h1,3-6,8-12H,2H2;1H3,(H,3,4) |
| InChI Key | VJHCJDRQFCCTHL-UHFFFAOYSA-N |
What is methyl cellulose made of?
Methyl cellulose is made from natural cellulose with white to milk-white colour. It is a tasteless powder (Fig. 8.32). It has multiple functions such as film-forming, emulsifiability, adhesive property and thickening property and is widely used in baked goods, fried foods, desserts, candies and soups as food additives.
Is methylcellulose a chemical?
Methyl Cellulose is a non-digestible, non-toxic chemical compound derived from cellulose. In its pure form the hydrophilic white powder dissolves in cold water to form a clear viscous solution or gel.
What is the function of methylcellulose?
This medication is used to treat constipation. It increases the bulk in your stool, an effect that helps to cause movement of the intestines. It also works by increasing the amount of water in the stool, making the stool softer and easier to pass.
What is the chemical formula of cellulose?
(C6H10O5)nCellulose / Formula
Cellulose is an organic compound with the formula (C6H10O5)n, a polysaccharide consisting of a linear chain of several hundred to many thousands of β(1→4) linked D-glucose units.
What is the difference between methylcellulose and cellulose?
Methyl cellulose (or methylcellulose) is a chemical compound derived from cellulose. It is sold under a variety of trade names and is used as a thickener and emulsifier in various food and cosmetic products, and also as a bulk-forming laxative.
What is the chemical nature of cellulose?
Cellulose is a natural linear polymer (polysaccharide), composed of glucose units, with the formula (C6H10O5)X. It is generally synthesized by plants. Biodegradability and resistance to hydrolysis are the main properties of this polysaccharide.
Is methylcellulose soluble in water?
MC is used widely in oral solid pharmaceutical formulations as a binder, coating agent, and as a controlled release matrix. MC is soluble in water (up to 55°C). This indicates slightly higher water solubility than HPC. Its aqueous solution exhibits thermal gelation properties at elevated temperatures.
What is the mechanism of action of methylcellulose?
Methylcellulose absorbs water in the gastrointestinal lumen thereby increasing the bulk of the stool. This leads to distension and stimulation of peristalsis.
